C12H25NO — CID 146334856
1-[(2R)-2-methyl-3-[(2-methylpropan-2-yl)oxy]propyl]pyrrolidine (PubChem CID 146334856) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is 1-[(2R)-2-methyl-3-[(2-methylpropan-2-yl)oxy]propyl]pyrrolidine.
| Compound Name | 1-[(2R)-2-methyl-3-[(2-methylpropan-2-yl)oxy]propyl]pyrrolidine |
|---|---|
| PubChem CID | 146334856 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 1-[(2R)-2-methyl-3-[(2-methylpropan-2-yl)oxy]propyl]pyrrolidine |
| SMILES | C[C@@H](COC(C)(C)C)CN1CCCC1 |
| InChI | InChI=1S/C12H25NO/c1-11(10-14-12(2,3)4)9-13-7-5-6-8-13/h11H,5-10H2,1-4H3/t11-/m1/s1 |
| InChIKey | PRGORGMHHPHTIR-LLVKDONJSA-N |
| XLogP | 2.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |