C14H28N2O2 — CID 66337589
tert-butyl 2-(1-pyrrolidin-1-ylpropan-2-ylamino)propanoate (PubChem CID 66337589) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is tert-butyl 2-(1-pyrrolidin-1-ylpropan-2-ylamino)propanoate.
| Compound Name | tert-butyl 2-(1-pyrrolidin-1-ylpropan-2-ylamino)propanoate |
|---|---|
| PubChem CID | 66337589 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | tert-butyl 2-(1-pyrrolidin-1-ylpropan-2-ylamino)propanoate |
| SMILES | CC(CN1CCCC1)NC(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28N2O2/c1-11(10-16-8-6-7-9-16)15-12(2)13(17)18-14(3,4)5/h11-12,15H,6-10H2,1-5H3 |
| InChIKey | RRVORQVOCRSVGQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |