C15H30N2O2 — CID 101375813
tert-butyl N-[(2S)-3-methyl-1-pyrrolidin-1-ylpentan-2-yl]carbamate (PubChem CID 101375813) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-methyl-1-pyrrolidin-1-ylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-methyl-1-pyrrolidin-1-ylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 101375813 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | tert-butyl N-[(2S)-3-methyl-1-pyrrolidin-1-ylpentan-2-yl]carbamate |
| SMILES | CCC(C)[C@@H](CN1CCCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30N2O2/c1-6-12(2)13(11-17-9-7-8-10-17)16-14(18)19-15(3,4)5/h12-13H,6-11H2,1-5H3,(H,16,18)/t12?,13-/m1/s1 |
| InChIKey | JPIGIYODOWZRIX-ZGTCLIOFSA-N |
| XLogP | 3.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |