C11H21FN2O2 — CID 139781998
tert-butyl N-[(1R)-2-fluoro-1-pyrrolidin-1-ylethyl]carbamate (PubChem CID 139781998) has the molecular formula C11H21FN2O2 and a molecular weight of 232.30 g/mol. Its IUPAC name is tert-butyl N-[(1R)-2-fluoro-1-pyrrolidin-1-ylethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-2-fluoro-1-pyrrolidin-1-ylethyl]carbamate |
|---|---|
| PubChem CID | 139781998 |
| Molecular Formula | C11H21FN2O2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | tert-butyl N-[(1R)-2-fluoro-1-pyrrolidin-1-ylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CF)N1CCCC1 |
| InChI | InChI=1S/C11H21FN2O2/c1-11(2,3)16-10(15)13-9(8-12)14-6-4-5-7-14/h9H,4-8H2,1-3H3,(H,13,15)/t9-/m1/s1 |
| InChIKey | BHDOWGZWZDAILS-SECBINFHSA-N |
| XLogP | 1.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |