C18H35N3O5 — CID 145308799
tert-butyl N-[4-(tert-butylamino)-4-oxo-3-pyrrolidin-1-ylbutan-2-yl]carbamate;formic acid (PubChem CID 145308799) has the molecular formula C18H35N3O5 and a molecular weight of 373.49 g/mol. Its IUPAC name is tert-butyl N-[4-(tert-butylamino)-4-oxo-3-pyrrolidin-1-ylbutan-2-yl]carbamate;formic acid.
| Compound Name | tert-butyl N-[4-(tert-butylamino)-4-oxo-3-pyrrolidin-1-ylbutan-2-yl]carbamate;formic acid |
|---|---|
| PubChem CID | 145308799 |
| Molecular Formula | C18H35N3O5 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | tert-butyl N-[4-(tert-butylamino)-4-oxo-3-pyrrolidin-1-ylbutan-2-yl]carbamate;formic acid |
| SMILES | CC(NC(=O)OC(C)(C)C)C(C(=O)NC(C)(C)C)N1CCCC1.O=CO |
| InChI | InChI=1S/C17H33N3O3.CH2O2/c1-12(18-15(22)23-17(5,6)7)13(20-10-8-9-11-20)14(21)19-16(2,3)4;2-1-3/h12-13H,8-11H2,1-7H3,(H,18,22)(H,19,21);1H,(H,2,3) |
| InChIKey | XBNIQLQPIVOELM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|