C18H33BrN2O3 — CID 46838857
tert-butyl N-[(1S,2R)-1-bromo-1-cyclohexyl-3-morpholin-4-ylpropan-2-yl]carbamate (PubChem CID 46838857) has the molecular formula C18H33BrN2O3 and a molecular weight of 405.38 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R)-1-bromo-1-cyclohexyl-3-morpholin-4-ylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,2R)-1-bromo-1-cyclohexyl-3-morpholin-4-ylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 46838857 |
| Molecular Formula | C18H33BrN2O3 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | tert-butyl N-[(1S,2R)-1-bromo-1-cyclohexyl-3-morpholin-4-ylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CN1CCOCC1)[C@@H](Br)C1CCCCC1 |
| InChI | InChI=1S/C18H33BrN2O3/c1-18(2,3)24-17(22)20-15(13-21-9-11-23-12-10-21)16(19)14-7-5-4-6-8-14/h14-16H,4-13H2,1-3H3,(H,20,22)/t15-,16+/m1/s1 |
| InChIKey | WGZIKUCLZQNPJR-CVEARBPZSA-N |
| XLogP | 3.56 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|