C14H26BrNO2 — CID 24730282
tert-butyl N-(3-bromo-1-cyclohexylpropyl)carbamate (PubChem CID 24730282) has the molecular formula C14H26BrNO2 and a molecular weight of 320.27 g/mol. Its IUPAC name is tert-butyl N-(3-bromo-1-cyclohexylpropyl)carbamate.
| Compound Name | tert-butyl N-(3-bromo-1-cyclohexylpropyl)carbamate |
|---|---|
| PubChem CID | 24730282 |
| Molecular Formula | C14H26BrNO2 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | tert-butyl N-(3-bromo-1-cyclohexylpropyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCBr)C1CCCCC1 |
| InChI | InChI=1S/C14H26BrNO2/c1-14(2,3)18-13(17)16-12(9-10-15)11-7-5-4-6-8-11/h11-12H,4-10H2,1-3H3,(H,16,17) |
| InChIKey | SJYBJDIOAVOWPD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|