About O-(2,4-dimethylpentyl)hydroxylamine
O-(2,4-dimethylpentyl)hydroxylamine (PubChem CID 130481155) has the molecular formula C7H17NO
and a molecular weight of 131.22 g/mol. Its IUPAC name is O-(2,4-dimethylpentyl)hydroxylamine.
Molecular Properties
| Compound Name | O-(2,4-dimethylpentyl)hydroxylamine |
| PubChem CID | 130481155 |
| Molecular Formula | C7H17NO |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.13 |
| IUPAC Name | O-(2,4-dimethylpentyl)hydroxylamine |
| SMILES | CC(C)CC(C)CON |
| InChI | InChI=1S/C7H17NO/c1-6(2)4-7(3)5-9-8/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | DALAZAGPSMBTCB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-(2,4-dimethylpentyl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2,4-dimethylpentyl)hydroxylamine?
The IUPAC name of O-(2,4-dimethylpentyl)hydroxylamine (CID 130481155) is O-(2,4-dimethylpentyl)hydroxylamine.
What is the SMILES notation for O-(2,4-dimethylpentyl)hydroxylamine?
The canonical SMILES for O-(2,4-dimethylpentyl)hydroxylamine is CC(C)CC(C)CON.
What is the InChIKey of O-(2,4-dimethylpentyl)hydroxylamine?
The InChIKey is DALAZAGPSMBTCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO/c1-6(2)4-7(3)5-9-8/h6-7H,4-5,8H2,1-3H3.
What are the key properties of O-(2,4-dimethylpentyl)hydroxylamine?
O-(2,4-dimethylpentyl)hydroxylamine has a molecular weight of 131.22 g/mol, XLogP of 1.56, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2,4-dimethylpentyl)hydroxylamine is sourced from PubChem (CID 130481155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).