C12H22O2 — CID 156770832
2,4-dimethylpentyl 2-methylidenebutanoate (PubChem CID 156770832) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 2,4-dimethylpentyl 2-methylidenebutanoate.
| Compound Name | 2,4-dimethylpentyl 2-methylidenebutanoate |
|---|---|
| PubChem CID | 156770832 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2,4-dimethylpentyl 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)OCC(C)CC(C)C |
| InChI | InChI=1S/C12H22O2/c1-6-11(5)12(13)14-8-10(4)7-9(2)3/h9-10H,5-8H2,1-4H3 |
| InChIKey | YAEMVWAJBSYLDU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|