C17H34O2P+ — CID 134171436
[2,4-dimethyl-5-(2-methylprop-2-enoyloxy)pentyl]-triethylphosphanium (PubChem CID 134171436) has the molecular formula C17H34O2P+ and a molecular weight of 301.43 g/mol. Its IUPAC name is [2,4-dimethyl-5-(2-methylprop-2-enoyloxy)pentyl]-triethylphosphanium.
| Compound Name | [2,4-dimethyl-5-(2-methylprop-2-enoyloxy)pentyl]-triethylphosphanium |
|---|---|
| PubChem CID | 134171436 |
| Molecular Formula | C17H34O2P+ |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | [2,4-dimethyl-5-(2-methylprop-2-enoyloxy)pentyl]-triethylphosphanium |
| SMILES | C=C(C)C(=O)OCC(C)CC(C)C[P+](CC)(CC)CC |
| InChI | InChI=1S/C17H34O2P/c1-8-20(9-2,10-3)13-16(7)11-15(6)12-19-17(18)14(4)5/h15-16H,4,8-13H2,1-3,5-7H3/q+1 |
| InChIKey | GWBOLVPEHNJXON-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|