C23H42O5 — CID 89087416
[4-hydroxy-6-methyl-7-(2-methylprop-2-enoyloxy)heptan-3-yl] 2-tert-butyl-2,3,3-trimethylbutanoate (PubChem CID 89087416) has the molecular formula C23H42O5 and a molecular weight of 398.58 g/mol. Its IUPAC name is [4-hydroxy-6-methyl-7-(2-methylprop-2-enoyloxy)heptan-3-yl] 2-tert-butyl-2,3,3-trimethylbutanoate.
| Compound Name | [4-hydroxy-6-methyl-7-(2-methylprop-2-enoyloxy)heptan-3-yl] 2-tert-butyl-2,3,3-trimethylbutanoate |
|---|---|
| PubChem CID | 89087416 |
| Molecular Formula | C23H42O5 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | [4-hydroxy-6-methyl-7-(2-methylprop-2-enoyloxy)heptan-3-yl] 2-tert-butyl-2,3,3-trimethylbutanoate |
| SMILES | C=C(C)C(=O)OCC(C)CC(O)C(CC)OC(=O)C(C)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C23H42O5/c1-12-18(17(24)13-16(4)14-27-19(25)15(2)3)28-20(26)23(11,21(5,6)7)22(8,9)10/h16-18,24H,2,12-14H2,1,3-11H3 |
| InChIKey | CMIHGDPQIARULY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|