C14H31NO — CID 59906417
(2S)-N-tert-butyl-4-methyl-1-[(2-methylpropan-2-yl)oxy]pentan-2-amine (PubChem CID 59906417) has the molecular formula C14H31NO and a molecular weight of 229.41 g/mol. Its IUPAC name is (2S)-N-tert-butyl-4-methyl-1-[(2-methylpropan-2-yl)oxy]pentan-2-amine.
| Compound Name | (2S)-N-tert-butyl-4-methyl-1-[(2-methylpropan-2-yl)oxy]pentan-2-amine |
|---|---|
| PubChem CID | 59906417 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | (2S)-N-tert-butyl-4-methyl-1-[(2-methylpropan-2-yl)oxy]pentan-2-amine |
| SMILES | CC(C)C[C@@H](COC(C)(C)C)NC(C)(C)C |
| InChI | InChI=1S/C14H31NO/c1-11(2)9-12(15-13(3,4)5)10-16-14(6,7)8/h11-12,15H,9-10H2,1-8H3/t12-/m0/s1 |
| InChIKey | XIJGPBBHDVGYDO-LBPRGKRZSA-N |
| XLogP | 3.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |