C10H20ClNO2 — CID 167788378
2-chloro-N-[(2S)-1-[(2-methylpropan-2-yl)oxy]butan-2-yl]acetamide (PubChem CID 167788378) has the molecular formula C10H20ClNO2 and a molecular weight of 221.73 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-1-[(2-methylpropan-2-yl)oxy]butan-2-yl]acetamide.
| Compound Name | 2-chloro-N-[(2S)-1-[(2-methylpropan-2-yl)oxy]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 167788378 |
| Molecular Formula | C10H20ClNO2 |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-chloro-N-[(2S)-1-[(2-methylpropan-2-yl)oxy]butan-2-yl]acetamide |
| SMILES | CC[C@@H](COC(C)(C)C)NC(=O)CCl |
| InChI | InChI=1S/C10H20ClNO2/c1-5-8(12-9(13)6-11)7-14-10(2,3)4/h8H,5-7H2,1-4H3,(H,12,13)/t8-/m0/s1 |
| InChIKey | FNHZFSKVYPCSAJ-QMMMGPOBSA-N |
| XLogP | 1.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|