C10H18Cl2N2O3 — CID 162712779
2-chloro-N-[1-[2-[(2-chloroacetyl)amino]propoxy]propan-2-yl]acetamide (PubChem CID 162712779) has the molecular formula C10H18Cl2N2O3 and a molecular weight of 285.17 g/mol. Its IUPAC name is 2-chloro-N-[1-[2-[(2-chloroacetyl)amino]propoxy]propan-2-yl]acetamide.
| Compound Name | 2-chloro-N-[1-[2-[(2-chloroacetyl)amino]propoxy]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 162712779 |
| Molecular Formula | C10H18Cl2N2O3 |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-chloro-N-[1-[2-[(2-chloroacetyl)amino]propoxy]propan-2-yl]acetamide |
| SMILES | CC(COCC(C)NC(=O)CCl)NC(=O)CCl |
| InChI | InChI=1S/C10H18Cl2N2O3/c1-7(13-9(15)3-11)5-17-6-8(2)14-10(16)4-12/h7-8H,3-6H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | VKHKIJLRGCQYPV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|