C9H16Cl2N2O2 — CID 87981003
2-chloro-N-[4-[(2-chloroacetyl)amino]pentan-2-yl]acetamide (PubChem CID 87981003) has the molecular formula C9H16Cl2N2O2 and a molecular weight of 255.14 g/mol. Its IUPAC name is 2-chloro-N-[4-[(2-chloroacetyl)amino]pentan-2-yl]acetamide.
| Compound Name | 2-chloro-N-[4-[(2-chloroacetyl)amino]pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 87981003 |
| Molecular Formula | C9H16Cl2N2O2 |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2-chloro-N-[4-[(2-chloroacetyl)amino]pentan-2-yl]acetamide |
| SMILES | CC(CC(C)NC(=O)CCl)NC(=O)CCl |
| InChI | InChI=1S/C9H16Cl2N2O2/c1-6(12-8(14)4-10)3-7(2)13-9(15)5-11/h6-7H,3-5H2,1-2H3,(H,12,14)(H,13,15) |
| InChIKey | NKSSCHBHGYPUCY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|