C8H16ClNO2 — CID 103881700
2-chloro-N-(1-hydroxy-4-methylpentan-3-yl)acetamide (PubChem CID 103881700) has the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. Its IUPAC name is 2-chloro-N-(1-hydroxy-4-methylpentan-3-yl)acetamide.
| Compound Name | 2-chloro-N-(1-hydroxy-4-methylpentan-3-yl)acetamide |
|---|---|
| PubChem CID | 103881700 |
| Molecular Formula | C8H16ClNO2 |
| Molecular Weight | 193.67 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-chloro-N-(1-hydroxy-4-methylpentan-3-yl)acetamide |
| SMILES | CC(C)C(CCO)NC(=O)CCl |
| InChI | InChI=1S/C8H16ClNO2/c1-6(2)7(3-4-11)10-8(12)5-9/h6-7,11H,3-5H2,1-2H3,(H,10,12) |
| InChIKey | MIKSDXWSUJHNIG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.67 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|