C8H17NO2S — CID 106357968
N-(1-hydroxy-4-methylpentan-3-yl)-2-sulfanylacetamide (PubChem CID 106357968) has the molecular formula C8H17NO2S and a molecular weight of 191.30 g/mol. Its IUPAC name is N-(1-hydroxy-4-methylpentan-3-yl)-2-sulfanylacetamide.
| Compound Name | N-(1-hydroxy-4-methylpentan-3-yl)-2-sulfanylacetamide |
|---|---|
| PubChem CID | 106357968 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | N-(1-hydroxy-4-methylpentan-3-yl)-2-sulfanylacetamide |
| SMILES | CC(C)C(CCO)NC(=O)CS |
| InChI | InChI=1S/C8H17NO2S/c1-6(2)7(3-4-10)9-8(11)5-12/h6-7,10,12H,3-5H2,1-2H3,(H,9,11) |
| InChIKey | OJBWLQQWNSCSOK-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|