C30H56O3 — CID 167376520
2-[7-(3,7-dimethyloct-6-enoxy)-3,7-dimethyloctoxy]-2-methyl-6-methylideneoct-7-en-3-ol (PubChem CID 167376520) has the molecular formula C30H56O3 and a molecular weight of 464.78 g/mol. Its IUPAC name is 2-[7-(3,7-dimethyloct-6-enoxy)-3,7-dimethyloctoxy]-2-methyl-6-methylideneoct-7-en-3-ol.
| Compound Name | 2-[7-(3,7-dimethyloct-6-enoxy)-3,7-dimethyloctoxy]-2-methyl-6-methylideneoct-7-en-3-ol |
|---|---|
| PubChem CID | 167376520 |
| Molecular Formula | C30H56O3 |
| Molecular Weight | 464.78 g/mol |
| Exact Mass | 464.42 |
| IUPAC Name | 2-[7-(3,7-dimethyloct-6-enoxy)-3,7-dimethyloctoxy]-2-methyl-6-methylideneoct-7-en-3-ol |
| SMILES | C=CC(=C)CCC(O)C(C)(C)OCCC(C)CCCC(C)(C)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C30H56O3/c1-11-25(4)17-18-28(31)30(9,10)33-23-20-27(6)16-13-21-29(7,8)32-22-19-26(5)15-12-14-24(2)3/h11,14,26-28,31H,1,4,12-13,15-23H2,2-3,5-10H3 |
| InChIKey | PJDJFKOZPXSJPQ-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.78 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|