C28H48O3 — CID 167376522
2-[7-(3,7-dimethyloct-6-enoxy)-3,7-dimethyloctoxy]-2-phenylethanol (PubChem CID 167376522) has the molecular formula C28H48O3 and a molecular weight of 432.69 g/mol. Its IUPAC name is 2-[7-(3,7-dimethyloct-6-enoxy)-3,7-dimethyloctoxy]-2-phenylethanol.
| Compound Name | 2-[7-(3,7-dimethyloct-6-enoxy)-3,7-dimethyloctoxy]-2-phenylethanol |
|---|---|
| PubChem CID | 167376522 |
| Molecular Formula | C28H48O3 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.36 |
| IUPAC Name | 2-[7-(3,7-dimethyloct-6-enoxy)-3,7-dimethyloctoxy]-2-phenylethanol |
| SMILES | CC(C)=CCCC(C)CCOC(C)(C)CCCC(C)CCOC(CO)c1ccccc1 |
| InChI | InChI=1S/C28H48O3/c1-23(2)12-10-13-24(3)18-21-31-28(5,6)19-11-14-25(4)17-20-30-27(22-29)26-15-8-7-9-16-26/h7-9,12,15-16,24-25,27,29H,10-11,13-14,17-22H2,1-6H3 |
| InChIKey | ANYRXSFOBOVLPW-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|