C19H26O2 — CID 86310523
[(3S)-3,7-dimethyloct-6-enyl] (E)-3-phenylprop-2-enoate (PubChem CID 86310523) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is [(3S)-3,7-dimethyloct-6-enyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(3S)-3,7-dimethyloct-6-enyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 86310523 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | [(3S)-3,7-dimethyloct-6-enyl] (E)-3-phenylprop-2-enoate |
| SMILES | CC(C)=CCC[C@H](C)CCOC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H26O2/c1-16(2)8-7-9-17(3)14-15-21-19(20)13-12-18-10-5-4-6-11-18/h4-6,8,10-13,17H,7,9,14-15H2,1-3H3/b13-12+/t17-/m0/s1 |
| InChIKey | KMXKQELDKDGFRN-UJGDBWEASA-N |
| XLogP | 5.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|