C20H28O4 — CID 68597070
3,7-dimethyloct-6-enyl (E)-3-(2-hydroxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 68597070) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl (E)-3-(2-hydroxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | 3,7-dimethyloct-6-enyl (E)-3-(2-hydroxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 68597070 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 3,7-dimethyloct-6-enyl (E)-3-(2-hydroxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCCC(C)CCC=C(C)C)c(O)c1 |
| InChI | InChI=1S/C20H28O4/c1-15(2)6-5-7-16(3)12-13-24-20(22)11-9-17-8-10-18(23-4)14-19(17)21/h6,8-11,14,16,21H,5,7,12-13H2,1-4H3/b11-9+ |
| InChIKey | WTLZZMKHIJKWBG-PKNBQFBNSA-N |
| XLogP | 4.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|