C26H31NO3 — CID 91455714
3,7-dimethyloct-6-enyl 3-(3-benzamidophenyl)prop-2-enoate (PubChem CID 91455714) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl 3-(3-benzamidophenyl)prop-2-enoate.
| Compound Name | 3,7-dimethyloct-6-enyl 3-(3-benzamidophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 91455714 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 3,7-dimethyloct-6-enyl 3-(3-benzamidophenyl)prop-2-enoate |
| SMILES | CC(C)=CCCC(C)CCOC(=O)C=Cc1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C26H31NO3/c1-20(2)9-7-10-21(3)17-18-30-25(28)16-15-22-11-8-14-24(19-22)27-26(29)23-12-5-4-6-13-23/h4-6,8-9,11-16,19,21H,7,10,17-18H2,1-3H3,(H,27,29) |
| InChIKey | MAURCBQICVBQMB-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|