C19H28O2 — CID 12944529
3,7-dimethyloctyl (E)-3-phenylprop-2-enoate (PubChem CID 12944529) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 3,7-dimethyloctyl (E)-3-phenylprop-2-enoate.
| Compound Name | 3,7-dimethyloctyl (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 12944529 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 3,7-dimethyloctyl (E)-3-phenylprop-2-enoate |
| SMILES | CC(C)CCCC(C)CCOC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H28O2/c1-16(2)8-7-9-17(3)14-15-21-19(20)13-12-18-10-5-4-6-11-18/h4-6,10-13,16-17H,7-9,14-15H2,1-3H3/b13-12+ |
| InChIKey | ZZVJIXKMRZLYHT-OUKQBFOZSA-N |
| XLogP | 5.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|