C37H54N2O8 — CID 11308293
(E)-3-[3,5-bis[[4-(3,7-dimethyloct-6-enoxy)-4-oxobutanoyl]amino]phenyl]prop-2-enoic acid (PubChem CID 11308293) has the molecular formula C37H54N2O8 and a molecular weight of 654.85 g/mol. Its IUPAC name is (E)-3-[3,5-bis[[4-(3,7-dimethyloct-6-enoxy)-4-oxobutanoyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-bis[[4-(3,7-dimethyloct-6-enoxy)-4-oxobutanoyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11308293 |
| Molecular Formula | C37H54N2O8 |
| Molecular Weight | 654.85 g/mol |
| Exact Mass | 654.39 |
| IUPAC Name | (E)-3-[3,5-bis[[4-(3,7-dimethyloct-6-enoxy)-4-oxobutanoyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CC(C)=CCCC(C)CCOC(=O)CCC(=O)Nc1cc(/C=C/C(=O)O)cc(NC(=O)CCC(=O)OCCC(C)CCC=C(C)C)c1 |
| InChI | InChI=1S/C37H54N2O8/c1-26(2)9-7-11-28(5)19-21-46-36(44)17-14-33(40)38-31-23-30(13-16-35(42)43)24-32(25-31)39-34(41)15-18-37(45)47-22-20-29(6)12-8-10-27(3)4/h9-10,13,16,23-25,28-29H,7-8,11-12,14-15,17-22H2,1-6H3,(H,38,40)(H,39,41)(H,42,43)/b16-13+ |
| InChIKey | AZQFAYOOJCHTDQ-DTQAZKPQSA-N |
| XLogP | 7.85 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.85 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|