C34H48O4 — CID 175955108
3,7-dimethyloct-6-enyl benzoate;2-(3,7-dimethyloct-6-enyl)benzoic acid (PubChem CID 175955108) has the molecular formula C34H48O4 and a molecular weight of 520.75 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl benzoate;2-(3,7-dimethyloct-6-enyl)benzoic acid.
| Compound Name | 3,7-dimethyloct-6-enyl benzoate;2-(3,7-dimethyloct-6-enyl)benzoic acid |
|---|---|
| PubChem CID | 175955108 |
| Molecular Formula | C34H48O4 |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | 3,7-dimethyloct-6-enyl benzoate;2-(3,7-dimethyloct-6-enyl)benzoic acid |
| SMILES | CC(C)=CCCC(C)CCOC(=O)c1ccccc1.CC(C)=CCCC(C)CCc1ccccc1C(=O)O |
| InChI | InChI=1S/2C17H24O2/c1-13(2)7-6-8-14(3)11-12-15-9-4-5-10-16(15)17(18)19;1-14(2)8-7-9-15(3)12-13-19-17(18)16-10-5-4-6-11-16/h4-5,7,9-10,14H,6,8,11-12H2,1-3H3,(H,18,19);4-6,8,10-11,15H,7,9,12-13H2,1-3H3 |
| InChIKey | DBFYYDWDDHGSDH-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|