C26H36O5 — CID 68597604
3,7-dimethyloct-6-enyl 3-(2-hex-3-enoxycarbonyloxyphenyl)prop-2-enoate (PubChem CID 68597604) has the molecular formula C26H36O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl 3-(2-hex-3-enoxycarbonyloxyphenyl)prop-2-enoate.
| Compound Name | 3,7-dimethyloct-6-enyl 3-(2-hex-3-enoxycarbonyloxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 68597604 |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 3,7-dimethyloct-6-enyl 3-(2-hex-3-enoxycarbonyloxyphenyl)prop-2-enoate |
| SMILES | CCC=CCCOC(=O)Oc1ccccc1C=CC(=O)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C26H36O5/c1-5-6-7-10-19-30-26(28)31-24-15-9-8-14-23(24)16-17-25(27)29-20-18-22(4)13-11-12-21(2)3/h6-9,12,14-17,22H,5,10-11,13,18-20H2,1-4H3 |
| InChIKey | FFJQYRMSKVSHOU-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|