C27H40O4 — CID 70223374
1-O-(3,7-dimethyloct-6-enyl) 4-O-[3-(2-propan-2-ylphenyl)but-1-enyl] butanedioate (PubChem CID 70223374) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is 1-O-(3,7-dimethyloct-6-enyl) 4-O-[3-(2-propan-2-ylphenyl)but-1-enyl] butanedioate.
| Compound Name | 1-O-(3,7-dimethyloct-6-enyl) 4-O-[3-(2-propan-2-ylphenyl)but-1-enyl] butanedioate |
|---|---|
| PubChem CID | 70223374 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 1-O-(3,7-dimethyloct-6-enyl) 4-O-[3-(2-propan-2-ylphenyl)but-1-enyl] butanedioate |
| SMILES | CC(C)=CCCC(C)CCOC(=O)CCC(=O)OC=CC(C)c1ccccc1C(C)C |
| InChI | InChI=1S/C27H40O4/c1-20(2)10-9-11-22(5)16-18-30-26(28)14-15-27(29)31-19-17-23(6)25-13-8-7-12-24(25)21(3)4/h7-8,10,12-13,17,19,21-23H,9,11,14-16,18H2,1-6H3 |
| InChIKey | XUYLGNKTLWSHNN-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|