C18H13F5O4 — CID 8604525
(2,3,4,5,6-pentafluorophenyl)methyl (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 8604525) has the molecular formula C18H13F5O4 and a molecular weight of 388.29 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8604525 |
| Molecular Formula | C18H13F5O4 |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCc2c(F)c(F)c(F)c(F)c2F)c(OC)c1 |
| InChI | InChI=1S/C18H13F5O4/c1-25-10-5-3-9(12(7-10)26-2)4-6-13(24)27-8-11-14(19)16(21)18(23)17(22)15(11)20/h3-7H,8H2,1-2H3/b6-4+ |
| InChIKey | XVFOYOUMLUNJSA-GQCTYLIASA-N |
| XLogP | 4.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|