C19H15F5O4 — CID 7654255
(2,3,4,5,6-pentafluorophenyl)methyl (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 7654255) has the molecular formula C19H15F5O4 and a molecular weight of 402.32 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7654255 |
| Molecular Formula | C19H15F5O4 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(/C=C/C(=O)OCc2c(F)c(F)c(F)c(F)c2F)cc1OC |
| InChI | InChI=1S/C19H15F5O4/c1-3-27-12-6-4-10(8-13(12)26-2)5-7-14(25)28-9-11-15(20)17(22)19(24)18(23)16(11)21/h4-8H,3,9H2,1-2H3/b7-5+ |
| InChIKey | BLMFFURGIXKDGX-FNORWQNLSA-N |
| XLogP | 4.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|