C22H21NO4 — CID 24577220
quinolin-8-ylmethyl (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 24577220) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is quinolin-8-ylmethyl (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | quinolin-8-ylmethyl (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 24577220 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | quinolin-8-ylmethyl (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(/C=C/C(=O)OCc2cccc3cccnc23)cc1OC |
| InChI | InChI=1S/C22H21NO4/c1-3-26-19-11-9-16(14-20(19)25-2)10-12-21(24)27-15-18-7-4-6-17-8-5-13-23-22(17)18/h4-14H,3,15H2,1-2H3/b12-10+ |
| InChIKey | JOJORBQNGBQKOE-ZRDIBKRKSA-N |
| XLogP | 4.40 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|