C18H16Cl2O4 — CID 2370953
(2,6-dichlorophenyl)methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 2370953) has the molecular formula C18H16Cl2O4 and a molecular weight of 367.23 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (2,6-dichlorophenyl)methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2370953 |
| Molecular Formula | C18H16Cl2O4 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | (2,6-dichlorophenyl)methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCc2c(Cl)cccc2Cl)cc1OC |
| InChI | InChI=1S/C18H16Cl2O4/c1-22-16-8-6-12(10-17(16)23-2)7-9-18(21)24-11-13-14(19)4-3-5-15(13)20/h3-10H,11H2,1-2H3/b9-7+ |
| InChIKey | CUTHKTACZFXXQW-VQHVLOKHSA-N |
| XLogP | 4.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|