C23H46O3 — CID 167013290
3,3,4-trimethyl-4-[5-methyl-5-(2-methylprop-2-enoxy)hexoxy]-1-[(2-methylpropan-2-yl)oxy]pentane (PubChem CID 167013290) has the molecular formula C23H46O3 and a molecular weight of 370.62 g/mol. Its IUPAC name is 3,3,4-trimethyl-4-[5-methyl-5-(2-methylprop-2-enoxy)hexoxy]-1-[(2-methylpropan-2-yl)oxy]pentane.
| Compound Name | 3,3,4-trimethyl-4-[5-methyl-5-(2-methylprop-2-enoxy)hexoxy]-1-[(2-methylpropan-2-yl)oxy]pentane |
|---|---|
| PubChem CID | 167013290 |
| Molecular Formula | C23H46O3 |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 370.34 |
| IUPAC Name | 3,3,4-trimethyl-4-[5-methyl-5-(2-methylprop-2-enoxy)hexoxy]-1-[(2-methylpropan-2-yl)oxy]pentane |
| SMILES | C=C(C)COC(C)(C)CCCCOC(C)(C)C(C)(C)CCOC(C)(C)C |
| InChI | InChI=1S/C23H46O3/c1-19(2)18-26-22(8,9)14-12-13-16-25-23(10,11)21(6,7)15-17-24-20(3,4)5/h1,12-18H2,2-11H3 |
| InChIKey | IBPGINIIVVFZHW-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|