C23H48FNO10 — CID 134254442
1-[4-amino-4-[4-fluoro-4-[3-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]propoxy]pentoxy]pentoxy]-3-(2-hydroxyethoxy)propan-2-ol (PubChem CID 134254442) has the molecular formula C23H48FNO10 and a molecular weight of 517.63 g/mol. Its IUPAC name is 1-[4-amino-4-[4-fluoro-4-[3-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]propoxy]pentoxy]pentoxy]-3-(2-hydroxyethoxy)propan-2-ol.
| Compound Name | 1-[4-amino-4-[4-fluoro-4-[3-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]propoxy]pentoxy]pentoxy]-3-(2-hydroxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 134254442 |
| Molecular Formula | C23H48FNO10 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.33 |
| IUPAC Name | 1-[4-amino-4-[4-fluoro-4-[3-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]propoxy]pentoxy]pentoxy]-3-(2-hydroxyethoxy)propan-2-ol |
| SMILES | CC(N)(CCCOCC(O)COCCO)OCCCC(C)(F)OCCCOCC(O)COCCO |
| InChI | InChI=1S/C23H48FNO10/c1-22(24,34-13-5-11-31-17-21(29)19-33-15-9-27)6-3-12-35-23(2,25)7-4-10-30-16-20(28)18-32-14-8-26/h20-21,26-29H,3-19,25H2,1-2H3 |
| InChIKey | BJKAFRICNHOUSR-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 162.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|