C13H26O5 — CID 90206824
[2-hydroxy-3-(2-hydroxyethoxy)propyl] 2,2-dimethylhexanoate (PubChem CID 90206824) has the molecular formula C13H26O5 and a molecular weight of 262.35 g/mol. Its IUPAC name is [2-hydroxy-3-(2-hydroxyethoxy)propyl] 2,2-dimethylhexanoate.
| Compound Name | [2-hydroxy-3-(2-hydroxyethoxy)propyl] 2,2-dimethylhexanoate |
|---|---|
| PubChem CID | 90206824 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | [2-hydroxy-3-(2-hydroxyethoxy)propyl] 2,2-dimethylhexanoate |
| SMILES | CCCCC(C)(C)C(=O)OCC(O)COCCO |
| InChI | InChI=1S/C13H26O5/c1-4-5-6-13(2,3)12(16)18-10-11(15)9-17-8-7-14/h11,14-15H,4-10H2,1-3H3 |
| InChIKey | HMIQTOFVCXTZIA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|