C16H30O4 — CID 169099011
(2-hydroxy-3-prop-2-enoxypropyl) 2-methyl-2-propylhexanoate (PubChem CID 169099011) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is (2-hydroxy-3-prop-2-enoxypropyl) 2-methyl-2-propylhexanoate.
| Compound Name | (2-hydroxy-3-prop-2-enoxypropyl) 2-methyl-2-propylhexanoate |
|---|---|
| PubChem CID | 169099011 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | (2-hydroxy-3-prop-2-enoxypropyl) 2-methyl-2-propylhexanoate |
| SMILES | C=CCOCC(O)COC(=O)C(C)(CCC)CCCC |
| InChI | InChI=1S/C16H30O4/c1-5-8-10-16(4,9-6-2)15(18)20-13-14(17)12-19-11-7-3/h7,14,17H,3,5-6,8-13H2,1-2,4H3 |
| InChIKey | WSLLTGZUAUFMEY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|