C33H60FNO10 — CID 138481957
4-[3-[3-[3-amino-3-[3-fluoro-3-[2-(2-hydroxy-3-phenoxypropoxy)ethoxy]butoxy]-2,2-dimethylbutoxy]-3-methylbutoxy]-2-hydroxypropoxy]butan-1-ol (PubChem CID 138481957) has the molecular formula C33H60FNO10 and a molecular weight of 649.84 g/mol. Its IUPAC name is 4-[3-[3-[3-amino-3-[3-fluoro-3-[2-(2-hydroxy-3-phenoxypropoxy)ethoxy]butoxy]-2,2-dimethylbutoxy]-3-methylbutoxy]-2-hydroxypropoxy]butan-1-ol.
| Compound Name | 4-[3-[3-[3-amino-3-[3-fluoro-3-[2-(2-hydroxy-3-phenoxypropoxy)ethoxy]butoxy]-2,2-dimethylbutoxy]-3-methylbutoxy]-2-hydroxypropoxy]butan-1-ol |
|---|---|
| PubChem CID | 138481957 |
| Molecular Formula | C33H60FNO10 |
| Molecular Weight | 649.84 g/mol |
| Exact Mass | 649.42 |
| IUPAC Name | 4-[3-[3-[3-amino-3-[3-fluoro-3-[2-(2-hydroxy-3-phenoxypropoxy)ethoxy]butoxy]-2,2-dimethylbutoxy]-3-methylbutoxy]-2-hydroxypropoxy]butan-1-ol |
| SMILES | CC(C)(CCOCC(O)COCCCCO)OCC(C)(C)C(C)(N)OCCC(C)(F)OCCOCC(O)COc1ccccc1 |
| InChI | InChI=1S/C33H60FNO10/c1-30(2,26-45-31(3,4)14-18-40-23-27(37)22-39-17-11-10-16-36)33(6,35)44-19-15-32(5,34)43-21-20-41-24-28(38)25-42-29-12-8-7-9-13-29/h7-9,12-13,27-28,36-38H,10-11,14-26,35H2,1-6H3 |
| InChIKey | BMHATWIKBJFWCI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 151.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.84 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|