C16H33NO4 — CID 129177449
4-[3-[(4-hydroxy-2-methylbutan-2-yl)amino]-3-methylbutoxy]-4-methylpentanoic acid (PubChem CID 129177449) has the molecular formula C16H33NO4 and a molecular weight of 303.44 g/mol. Its IUPAC name is 4-[3-[(4-hydroxy-2-methylbutan-2-yl)amino]-3-methylbutoxy]-4-methylpentanoic acid.
| Compound Name | 4-[3-[(4-hydroxy-2-methylbutan-2-yl)amino]-3-methylbutoxy]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 129177449 |
| Molecular Formula | C16H33NO4 |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | 4-[3-[(4-hydroxy-2-methylbutan-2-yl)amino]-3-methylbutoxy]-4-methylpentanoic acid |
| SMILES | CC(C)(CCO)NC(C)(C)CCOC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C16H33NO4/c1-14(2,9-11-18)17-15(3,4)10-12-21-16(5,6)8-7-13(19)20/h17-18H,7-12H2,1-6H3,(H,19,20) |
| InChIKey | BEVIWMDOTHCHHY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |