C17H30I2N2O3 — CID 129157443
4-[3-[(5-amino-3,4-diiodohexa-1,5-dien-2-yl)amino]-3-methylbutoxy]-4-methylpentanoic acid (PubChem CID 129157443) has the molecular formula C17H30I2N2O3 and a molecular weight of 564.25 g/mol. Its IUPAC name is 4-[3-[(5-amino-3,4-diiodohexa-1,5-dien-2-yl)amino]-3-methylbutoxy]-4-methylpentanoic acid.
| Compound Name | 4-[3-[(5-amino-3,4-diiodohexa-1,5-dien-2-yl)amino]-3-methylbutoxy]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 129157443 |
| Molecular Formula | C17H30I2N2O3 |
| Molecular Weight | 564.25 g/mol |
| Exact Mass | 564.03 |
| IUPAC Name | 4-[3-[(5-amino-3,4-diiodohexa-1,5-dien-2-yl)amino]-3-methylbutoxy]-4-methylpentanoic acid |
| SMILES | C=C(N)C(I)C(I)C(=C)NC(C)(C)CCOC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C17H30I2N2O3/c1-11(20)14(18)15(19)12(2)21-16(3,4)9-10-24-17(5,6)8-7-13(22)23/h14-15,21H,1-2,7-10,20H2,3-6H3,(H,22,23) |
| InChIKey | VTNFTQJTQPWHFC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.25 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|