C14H24O3 — CID 88942481
[2-methyl-4-(2-methylpent-4-en-2-yloxy)butan-2-yl] prop-2-enoate (PubChem CID 88942481) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is [2-methyl-4-(2-methylpent-4-en-2-yloxy)butan-2-yl] prop-2-enoate.
| Compound Name | [2-methyl-4-(2-methylpent-4-en-2-yloxy)butan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 88942481 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | [2-methyl-4-(2-methylpent-4-en-2-yloxy)butan-2-yl] prop-2-enoate |
| SMILES | C=CCC(C)(C)OCCC(C)(C)OC(=O)C=C |
| InChI | InChI=1S/C14H24O3/c1-7-9-13(3,4)16-11-10-14(5,6)17-12(15)8-2/h7-8H,1-2,9-11H2,3-6H3 |
| InChIKey | AKADIWUKFVJJMF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|