C30H43NO4 — CID 137444505
[4-[1-amino-1-[4-[2-[4-(2-ethoxypropan-2-yl)phenyl]propan-2-yl]phenyl]ethoxy]-2-methylbutan-2-yl] prop-2-enoate (PubChem CID 137444505) has the molecular formula C30H43NO4 and a molecular weight of 481.68 g/mol. Its IUPAC name is [4-[1-amino-1-[4-[2-[4-(2-ethoxypropan-2-yl)phenyl]propan-2-yl]phenyl]ethoxy]-2-methylbutan-2-yl] prop-2-enoate.
| Compound Name | [4-[1-amino-1-[4-[2-[4-(2-ethoxypropan-2-yl)phenyl]propan-2-yl]phenyl]ethoxy]-2-methylbutan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 137444505 |
| Molecular Formula | C30H43NO4 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.32 |
| IUPAC Name | [4-[1-amino-1-[4-[2-[4-(2-ethoxypropan-2-yl)phenyl]propan-2-yl]phenyl]ethoxy]-2-methylbutan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C)(C)CCOC(C)(N)c1ccc(C(C)(C)c2ccc(C(C)(C)OCC)cc2)cc1 |
| InChI | InChI=1S/C30H43NO4/c1-10-26(32)35-27(3,4)20-21-34-30(9,31)25-18-14-23(15-19-25)28(5,6)22-12-16-24(17-13-22)29(7,8)33-11-2/h10,12-19H,1,11,20-21,31H2,2-9H3 |
| InChIKey | GOKCYFFNWYPMOO-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|