C11H20O2 — CID 19774400
ethenyl 2,2,4,4-tetramethylpentanoate (PubChem CID 19774400) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is ethenyl 2,2,4,4-tetramethylpentanoate.
| Compound Name | ethenyl 2,2,4,4-tetramethylpentanoate |
|---|---|
| PubChem CID | 19774400 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | ethenyl 2,2,4,4-tetramethylpentanoate |
| SMILES | C=COC(=O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C11H20O2/c1-7-13-9(12)11(5,6)8-10(2,3)4/h7H,1,8H2,2-6H3 |
| InChIKey | BEBSSWYECUCQHK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|