C14H26O8 — CID 91049611
2,2-dimethylpropanoylperoxyperoxy 2,2,4,4-tetramethylpentaneperoxoate (PubChem CID 91049611) has the molecular formula C14H26O8 and a molecular weight of 322.35 g/mol. Its IUPAC name is 2,2-dimethylpropanoylperoxyperoxy 2,2,4,4-tetramethylpentaneperoxoate.
| Compound Name | 2,2-dimethylpropanoylperoxyperoxy 2,2,4,4-tetramethylpentaneperoxoate |
|---|---|
| PubChem CID | 91049611 |
| Molecular Formula | C14H26O8 |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 2,2-dimethylpropanoylperoxyperoxy 2,2,4,4-tetramethylpentaneperoxoate |
| SMILES | CC(C)(C)CC(C)(C)C(=O)OOOOOOC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H26O8/c1-12(2,3)9-14(7,8)11(16)18-20-22-21-19-17-10(15)13(4,5)6/h9H2,1-8H3 |
| InChIKey | HJWSSSZKACRVSB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|