C10H18O5 — CID 126746926
2-(4-hydroxy-2,2,4-trimethylpentanoyl)oxyacetic acid (PubChem CID 126746926) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is 2-(4-hydroxy-2,2,4-trimethylpentanoyl)oxyacetic acid.
| Compound Name | 2-(4-hydroxy-2,2,4-trimethylpentanoyl)oxyacetic acid |
|---|---|
| PubChem CID | 126746926 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-(4-hydroxy-2,2,4-trimethylpentanoyl)oxyacetic acid |
| SMILES | CC(C)(O)CC(C)(C)C(=O)OCC(=O)O |
| InChI | InChI=1S/C10H18O5/c1-9(2,6-10(3,4)14)8(13)15-5-7(11)12/h14H,5-6H2,1-4H3,(H,11,12) |
| InChIKey | LLFRXABHOFUJLZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |