C15H30O3 — CID 155394736
(4-hydroxy-2,2,4-trimethylpentyl) 2,2-dimethylpentanoate (PubChem CID 155394736) has the molecular formula C15H30O3 and a molecular weight of 258.40 g/mol. Its IUPAC name is (4-hydroxy-2,2,4-trimethylpentyl) 2,2-dimethylpentanoate.
| Compound Name | (4-hydroxy-2,2,4-trimethylpentyl) 2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 155394736 |
| Molecular Formula | C15H30O3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | (4-hydroxy-2,2,4-trimethylpentyl) 2,2-dimethylpentanoate |
| SMILES | CCCC(C)(C)C(=O)OCC(C)(C)CC(C)(C)O |
| InChI | InChI=1S/C15H30O3/c1-8-9-14(4,5)12(16)18-11-13(2,3)10-15(6,7)17/h17H,8-11H2,1-7H3 |
| InChIKey | OECYYWVJMRBILQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |