C20H36O6 — CID 59988006
[2,2-dimethyl-3-(2-methylbutanoyloxy)propyl] 2,2-dimethyl-3-(2-methylbutanoyloxy)propanoate (PubChem CID 59988006) has the molecular formula C20H36O6 and a molecular weight of 372.50 g/mol. Its IUPAC name is [2,2-dimethyl-3-(2-methylbutanoyloxy)propyl] 2,2-dimethyl-3-(2-methylbutanoyloxy)propanoate.
| Compound Name | [2,2-dimethyl-3-(2-methylbutanoyloxy)propyl] 2,2-dimethyl-3-(2-methylbutanoyloxy)propanoate |
|---|---|
| PubChem CID | 59988006 |
| Molecular Formula | C20H36O6 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | [2,2-dimethyl-3-(2-methylbutanoyloxy)propyl] 2,2-dimethyl-3-(2-methylbutanoyloxy)propanoate |
| SMILES | CCC(C)C(=O)OCC(C)(C)COC(=O)C(C)(C)COC(=O)C(C)CC |
| InChI | InChI=1S/C20H36O6/c1-9-14(3)16(21)24-11-19(5,6)12-26-18(23)20(7,8)13-25-17(22)15(4)10-2/h14-15H,9-13H2,1-8H3 |
| InChIKey | WARGAHPWZUFODE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|