C21H38O2 — CID 155718140
2,2-dimethylpentyl 2-methylbutanoate;ethane;toluene (PubChem CID 155718140) has the molecular formula C21H38O2 and a molecular weight of 322.53 g/mol. Its IUPAC name is 2,2-dimethylpentyl 2-methylbutanoate;ethane;toluene.
| Compound Name | 2,2-dimethylpentyl 2-methylbutanoate;ethane;toluene |
|---|---|
| PubChem CID | 155718140 |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.29 |
| IUPAC Name | 2,2-dimethylpentyl 2-methylbutanoate;ethane;toluene |
| SMILES | CC.CCCC(C)(C)COC(=O)C(C)CC.Cc1ccccc1 |
| InChI | InChI=1S/C12H24O2.C7H8.C2H6/c1-6-8-12(4,5)9-14-11(13)10(3)7-2;1-7-5-3-2-4-6-7;1-2/h10H,6-9H2,1-5H3;2-6H,1H3;1-2H3 |
| InChIKey | GHPJSWXCVCAMDS-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |