About isocyanomethyl 2-methylbutanoate
isocyanomethyl 2-methylbutanoate (PubChem CID 59266759) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is isocyanomethyl 2-methylbutanoate.
Molecular Properties
| Compound Name | isocyanomethyl 2-methylbutanoate |
| PubChem CID | 59266759 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | isocyanomethyl 2-methylbutanoate |
| SMILES | [C-]#[N+]COC(=O)C(C)CC |
| InChI | InChI=1S/C7H11NO2/c1-4-6(2)7(9)10-5-8-3/h6H,4-5H2,1-2H3 |
| InChIKey | MAODRQZWSIPMIY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze isocyanomethyl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanomethyl 2-methylbutanoate?
The IUPAC name of isocyanomethyl 2-methylbutanoate (CID 59266759) is isocyanomethyl 2-methylbutanoate.
What is the SMILES notation for isocyanomethyl 2-methylbutanoate?
The canonical SMILES for isocyanomethyl 2-methylbutanoate is [C-]#[N+]COC(=O)C(C)CC.
What is the InChIKey of isocyanomethyl 2-methylbutanoate?
The InChIKey is MAODRQZWSIPMIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-4-6(2)7(9)10-5-8-3/h6H,4-5H2,1-2H3.
What are the key properties of isocyanomethyl 2-methylbutanoate?
isocyanomethyl 2-methylbutanoate has a molecular weight of 141.17 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanomethyl 2-methylbutanoate is sourced from PubChem (CID 59266759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).