About (4-hydroxy-2,2-dimethylbutyl) 3-hydroxy-2,2-dimethylpropanoate
(4-hydroxy-2,2-dimethylbutyl) 3-hydroxy-2,2-dimethylpropanoate (PubChem CID 54059951) has the molecular formula C11H22O4
and a molecular weight of 218.29 g/mol. Its IUPAC name is (4-hydroxy-2,2-dimethylbutyl) 3-hydroxy-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (4-hydroxy-2,2-dimethylbutyl) 3-hydroxy-2,2-dimethylpropanoate |
| PubChem CID | 54059951 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (4-hydroxy-2,2-dimethylbutyl) 3-hydroxy-2,2-dimethylpropanoate |
| SMILES | CC(C)(CCO)COC(=O)C(C)(C)CO |
| InChI | InChI=1S/C11H22O4/c1-10(2,5-6-12)8-15-9(14)11(3,4)7-13/h12-13H,5-8H2,1-4H3 |
| InChIKey | LYYWLLAXWOGYCY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-hydroxy-2,2-dimethylbutyl) 3-hydroxy-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-2,2-dimethylbutyl) 3-hydroxy-2,2-dimethylpropanoate?
The IUPAC name of (4-hydroxy-2,2-dimethylbutyl) 3-hydroxy-2,2-dimethylpropanoate (CID 54059951) is (4-hydroxy-2,2-dimethylbutyl) 3-hydroxy-2,2-dimethylpropanoate.
What is the SMILES notation for (4-hydroxy-2,2-dimethylbutyl) 3-hydroxy-2,2-dimethylpropanoate?
The canonical SMILES for (4-hydroxy-2,2-dimethylbutyl) 3-hydroxy-2,2-dimethylpropanoate is CC(C)(CCO)COC(=O)C(C)(C)CO.
What is the InChIKey of (4-hydroxy-2,2-dimethylbutyl) 3-hydroxy-2,2-dimethylpropanoate?
The InChIKey is LYYWLLAXWOGYCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O4/c1-10(2,5-6-12)8-15-9(14)11(3,4)7-13/h12-13H,5-8H2,1-4H3.
What are the key properties of (4-hydroxy-2,2-dimethylbutyl) 3-hydroxy-2,2-dimethylpropanoate?
(4-hydroxy-2,2-dimethylbutyl) 3-hydroxy-2,2-dimethylpropanoate has a molecular weight of 218.29 g/mol, XLogP of 0.96, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-2,2-dimethylbutyl) 3-hydroxy-2,2-dimethylpropanoate is sourced from PubChem (CID 54059951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).