C13H27NO2 — CID 123226965
2-methylbutan-2-yl 4-amino-2,2,4-trimethylpentanoate (PubChem CID 123226965) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 2-methylbutan-2-yl 4-amino-2,2,4-trimethylpentanoate.
| Compound Name | 2-methylbutan-2-yl 4-amino-2,2,4-trimethylpentanoate |
|---|---|
| PubChem CID | 123226965 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 2-methylbutan-2-yl 4-amino-2,2,4-trimethylpentanoate |
| SMILES | CCC(C)(C)OC(=O)C(C)(C)CC(C)(C)N |
| InChI | InChI=1S/C13H27NO2/c1-8-13(6,7)16-10(15)11(2,3)9-12(4,5)14/h8-9,14H2,1-7H3 |
| InChIKey | XPZYNSSEDOGWMV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |