About bis(2-methylbutan-2-yl) 2-aminopropanedioate
bis(2-methylbutan-2-yl) 2-aminopropanedioate (PubChem CID 141226339) has the molecular formula C13H25NO4
and a molecular weight of 259.35 g/mol. Its IUPAC name is bis(2-methylbutan-2-yl) 2-aminopropanedioate.
Molecular Properties
| Compound Name | bis(2-methylbutan-2-yl) 2-aminopropanedioate |
| PubChem CID | 141226339 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | bis(2-methylbutan-2-yl) 2-aminopropanedioate |
| SMILES | CCC(C)(C)OC(=O)C(N)C(=O)OC(C)(C)CC |
| InChI | InChI=1S/C13H25NO4/c1-7-12(3,4)17-10(15)9(14)11(16)18-13(5,6)8-2/h9H,7-8,14H2,1-6H3 |
| InChIKey | MWSSSCBZFLWAEW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylbutan-2-yl) 2-aminopropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylbutan-2-yl) 2-aminopropanedioate?
The IUPAC name of bis(2-methylbutan-2-yl) 2-aminopropanedioate (CID 141226339) is bis(2-methylbutan-2-yl) 2-aminopropanedioate.
What is the SMILES notation for bis(2-methylbutan-2-yl) 2-aminopropanedioate?
The canonical SMILES for bis(2-methylbutan-2-yl) 2-aminopropanedioate is CCC(C)(C)OC(=O)C(N)C(=O)OC(C)(C)CC.
What is the InChIKey of bis(2-methylbutan-2-yl) 2-aminopropanedioate?
The InChIKey is MWSSSCBZFLWAEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO4/c1-7-12(3,4)17-10(15)9(14)11(16)18-13(5,6)8-2/h9H,7-8,14H2,1-6H3.
What are the key properties of bis(2-methylbutan-2-yl) 2-aminopropanedioate?
bis(2-methylbutan-2-yl) 2-aminopropanedioate has a molecular weight of 259.35 g/mol, XLogP of 1.78, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylbutan-2-yl) 2-aminopropanedioate is sourced from PubChem (CID 141226339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).